- 5-Methyloxazol-2-amine
-
- $1.07 / 1Kg
-
2025-12-12
- CAS:33124-04-8
- Min. Order: 1Kg
- Purity: 99.0%
- Supply Ability: 60 tons
- 5-Methyloxazol-2-amine
-
- $0.00 / 25KG
-
2025-12-01
- CAS:33124-04-8
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | 5-METHYL-OXAZOL-2-YLAMINE Basic information |
| Product Name: | 5-METHYL-OXAZOL-2-YLAMINE | | Synonyms: | 5-METHYL-OXAZOL-2-YLAMINE;5-METHYLOXAZOL-2-AMINE;2-AMino-5-Methyloxazole;5-Methyl-1,3-oxazol-2-aMine;2-Oxazolamine, 5-methyl-;5-Methyloxazol-2-amine , 5-methyl-1,3-oxazol-2-amine | | CAS: | 33124-04-8 | | MF: | C4H6N2O | | MW: | 98.1 | | EINECS: | | | Product Categories: | | | Mol File: | 33124-04-8.mol |  |
| | 5-METHYL-OXAZOL-2-YLAMINE Chemical Properties |
| Boiling point | 203.2±33.0 °C(Predicted) | | density | 1.167±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 6.17±0.10(Predicted) | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C4H6N2O/c1-3-2-6-4(5)7-3/h2H,1H3,(H2,5,6) | | InChIKey | DYYFCNDEROYKKJ-UHFFFAOYSA-N | | SMILES | O1C(C)=CN=C1N |
| | 5-METHYL-OXAZOL-2-YLAMINE Usage And Synthesis |
| Chemical Properties | White crystalline | | Uses | 5-Methyl-oxazol-2-ylamine is a synthetic building block that can be used to prepare anti-cancer and anti-inflammatory drugs, luminescent metal complexes, or chemical reagents. |
| | 5-METHYL-OXAZOL-2-YLAMINE Preparation Products And Raw materials |
|