|
|
| | ISOOCTYL ACRYLATE Basic information |
| | ISOOCTYL ACRYLATE Chemical Properties |
| Melting point | -58.7°C (estimate) | | Boiling point | 125 °C20 mm Hg(lit.) | | density | 0.88 g/mL at 25 °C(lit.) | | vapor pressure | 1.067hPa at 20℃ | | refractive index | n20/D 1.437(lit.) | | Fp | 177 °F | | form | Liquid | | InChI | InChI=1S/C11H20O2/c1-4-11(12)13-9-7-5-6-8-10(2)3/h4,10H,1,5-9H2,2-3H3 | | InChIKey | DXPPIEDUBFUSEZ-UHFFFAOYSA-N | | SMILES | C(=O)(C=C)OCCCCCC(C)C | | LogP | 4.5-4.7 at 25℃ and pH7 | | CAS DataBase Reference | 29590-42-9(CAS DataBase Reference) | | EPA Substance Registry System | Isooctyl acrylate (29590-42-9) |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-51/53-50/53 | | Safety Statements | 26-28-61-60-2 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 2 | | RTECS | UD3391000 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29161240 |
| | ISOOCTYL ACRYLATE Usage And Synthesis |
| Uses | Isooctyl acrylate may be used to prepare linear copolymers with cinnamoyloxyethyl methacrylate (CEMA) for applications as oil absorbents. Copolymer of isooctyl acrylate /acrylamine (1:1 mole ratio) was studied as a magnetoelastic CO2 sensor With high sensitivity. Isooctyl acrylate (IOA) based copolymers may be used to prepare pressure-sensitive acrylic medical grade adhesives for skin.
| | General Description | The structure of Isooctyl acrylate consists of eight carbon alkyl esters of acrylic acid. |
| | ISOOCTYL ACRYLATE Preparation Products And Raw materials |
|