|
|
| | PARAROSANILINE ACETATE Basic information |
| Product Name: | PARAROSANILINE ACETATE | | Synonyms: | onoacetate;P-ROSANILINE ACETATE;PARAFUCHSIN;PARAMAGENTA;PARAROSANILINE ACETATE;FUCHSIN PARA;CI NO 42500;LABOTEST-BB LT00159718 | | CAS: | 6035-94-5 | | MF: | C21H21N3O2 | | MW: | 347.41 | | EINECS: | 227-918-6 | | Product Categories: | | | Mol File: | 6035-94-5.mol |  |
| | PARAROSANILINE ACETATE Chemical Properties |
| Melting point | 203 °C (dec.)(lit.) | | Boiling point | 481.96°C (rough estimate) | | density | 1.1921 (rough estimate) | | refractive index | 1.6300 (estimate) | | storage temp. | room temp | | solubility | 95% ethanol: 0.1% | | Colour Index | 42500 | | form | solid | | Water Solubility | 1.7μg/L | | ε(extinction coefficient) | ≥11000 at 235-241nm in ethanol: water (1:1) at 0.004%
≥16000 at 286-292nm in ethanol: water (1:1) at 0.004%
≥78000 at 543-549nm in ethanol: water (1:1) at 0.004% | | λmax | 545 nm | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C19H17N3.C2H4O2/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15;1-2(3)4/h1-12,20H,21-22H2;1H3,(H,3,4) | | InChIKey | YIXIVOYGLPFDCY-UHFFFAOYSA-N | | SMILES | CC(O)=O.Nc1ccc(cc1)C(\c2ccc(N)cc2)=C3\C=CC(=N)C=C3 | | LogP | 3.194 | | EPA Substance Registry System | Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-, monoacetate (6035-94-5) |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | PARAROSANILINE ACETATE Usage And Synthesis |
| Uses | diagnostic assay manufacturing
hematology
histology | | Flammability and Explosibility | Not classified | | Biological Activity | Pararosaniline acetate is one of the components of basic fuchsin. It acts as a reversible, linear inhibitor of horse butyrylcholinesterase (BChE). |
| | PARAROSANILINE ACETATE Preparation Products And Raw materials |
|