| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Naphthalene (13C6) Basic information |
| | Naphthalene (13C6) Chemical Properties |
| Melting point | 80-82°C (lit.) | | Boiling point | 218°C (lit.) | | InChI | 1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1+1,2+1,5+1,6+1,9+1,10+1 | | InChIKey | UFWIBTONFRDIAS-TUSAXXEXSA-N | | SMILES | c1cc[13c]2[13cH][13cH][13cH][13cH][13c]2c1 |
| WGK Germany | WGK 3 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Flam. Sol. 2 |
| | Naphthalene (13C6) Usage And Synthesis |
| Uses | Labelled polycyclic aromatic hydrocarbons as micropollutants. |
| | Naphthalene (13C6) Preparation Products And Raw materials |
|