|
|
| | (S)-N-FMOC-2-Thienylalanine Basic information |
| | (S)-N-FMOC-2-Thienylalanine Chemical Properties |
| Melting point | 218.5 °C | | Boiling point | 623.4±55.0 °C(Predicted) | | density | 1.2174 (rough estimate) | | refractive index | 1.5060 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | pka | 3.59±0.10(Predicted) | | form | Solid | | color | White to off-white | | Major Application | peptide synthesis | | InChI | InChI=1/C22H19NO4S/c24-21(25)20(12-14-6-5-11-28-14)23-22(26)27-13-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-11,19-20H,12-13H2,(H,23,26)(H,24,25)/t20-/s3 | | InChIKey | PXBMQFMUHRNKTG-FQEVSTJZSA-N | | SMILES | C1(COC(=O)N[C@H](C(=O)O)CC2SC=CC=2)C2=CC=CC=C2C2=CC=CC=C12 |&1:6,r| | | CAS DataBase Reference | 130309-35-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2934 99 90 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | (S)-N-FMOC-2-Thienylalanine Usage And Synthesis |
| Chemical Properties | off-white to light beige crystalline powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | (S)-N-FMOC-2-Thienylalanine Preparation Products And Raw materials |
|