2-Amino-3,5-difluoropyridine manufacturers
|
| | 2-Amino-3,5-difluoropyridine Basic information |
| Product Name: | 2-Amino-3,5-difluoropyridine | | Synonyms: | 2-AMINO-3,5-DIFLUOROPYRIDINE;2-Pyridinamine,3,5-difluoro-(9CI);3,5-Difluoro-2-aMinopyridine;3,5-Difluoropyridin-2-aMine;3,5-Difluoropyridin-2-ylamine;2-Amino-3,5-difL;2-Pyridinamine, 3,5-difluoro-;2-Amino-3,5-difluoropyridine ISO 9001：2015 REACH | | CAS: | 732306-31-9 | | MF: | C5H4F2N2 | | MW: | 130.1 | | EINECS: | | | Product Categories: | PYRIDINE;AMINEPRIMARY | | Mol File: | 732306-31-9.mol |  |
| | 2-Amino-3,5-difluoropyridine Chemical Properties |
| Melting point | 55-57 | | Boiling point | 155.8±35.0 °C(Predicted) | | density | 1.393±0.06 g/cm3(Predicted) | | Fp | 81℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 1.67±0.49(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H4F2N2/c6-3-1-4(7)5(8)9-2-3/h1-2H,(H2,8,9) | | InChIKey | JVLFMTZUPSBCNJ-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C(F)C=C1F | | CAS DataBase Reference | 732306-31-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | RIDADR | UN2811 | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 2-Amino-3,5-difluoropyridine Usage And Synthesis |
| Biological Activity | 2-Amino-3,5-difluoropyridine is a compound that has been shown to be an inhibitor of the hepatitis C virus. It has also been used in pharmaceutical preparations for infectious diseases, such as diabetic neuropathy. Hydrogen bonding plays an important role in the mechanism of 2-Amino-3,5-difluoropyridine and its interactions with other molecules. The antimicrobial activity of this molecule has been studied using solid dispersions and molecular modeling techniques. |
| | 2-Amino-3,5-difluoropyridine Preparation Products And Raw materials |
|