|
|
| | 6-Allyl-8beta-carboxyergoline Basic information |
| Product Name: | 6-Allyl-8beta-carboxyergoline | | Synonyms: | 6-(2-PROPENYL)-ERGOLINE-8-CARBOXYLIC ACID;6-Allyl-8β-carboxyergoline;Cabergoline impurity A -d;YAICYXFUKKMAKO-XNRPHZJLSA-N;(8b)-6-Allylergoline-8-carboxylic acid;6-(2-Propenyl)dihydrolysergic acid;Cabergoline EP Impurity A;(8β)-6-Allylergoline-8-carboxylic acid | | CAS: | 81409-74-7 | | MF: | C18H20N2O2 | | MW: | 296.36 | | EINECS: | | | Product Categories: | | | Mol File: | 81409-74-7.mol |  |
| | 6-Allyl-8beta-carboxyergoline Chemical Properties |
| Melting point | >160oC(dec.) | | Boiling point | 530.4±50.0 °C(Predicted) | | density | 1.258 | | storage temp. | Amber Vial, -20°C Freezer | | solubility | Dioxane (Sparingly), DMSO, Methanol (Sparingly) | | form | Solid | | pka | 3.77±0.20(Predicted) | | color | White to Light Beige to Pale Brown | | InChI | InChI=1/C18H20N2O2/c1-2-6-20-10-12(18(21)22)7-14-13-4-3-5-15-17(13)11(9-19-15)8-16(14)20/h2-5,9,12,14,16,19H,1,6-8,10H2,(H,21,22)/t12?,14-,16-/s3 | | InChIKey | YAICYXFUKKMAKO-SSILCPKXNA-N | | SMILES | [C@]12([H])CC(C(O)=O)CN(CC=C)[C@]1([H])CC1=CNC3=CC=CC2=C13 |&1:0,12,r| |
| | 6-Allyl-8beta-carboxyergoline Usage And Synthesis |
| Description | 6-Allyl-8beta-carboxyergoline is a pharmaceutical intermediate compound used in the preparation of Cabergoline, a drug for the treatment of high levels of prolactin in the blood. | | Uses | 6-Allyl-8β-carboxyergoline is a metabolite of cabergoline (C050000) which is a dopamine D2-receptor agonist. |
| | 6-Allyl-8beta-carboxyergoline Preparation Products And Raw materials |
|