|
|
| | BIS(2-FORMYLPHENYL) ETHER Basic information |
| | BIS(2-FORMYLPHENYL) ETHER Chemical Properties |
| Melting point | 78 °C | | Boiling point | 182 °C / 1.5mmHg | | density | 1.233±0.06 g/cm3(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C14H10O3/c15-9-11-5-1-3-7-13(11)17-14-8-4-2-6-12(14)10-16/h1-10H | | InChIKey | LMJZLKFWMQOYKU-UHFFFAOYSA-N | | SMILES | O(C1=CC=CC=C1C=O)C1=CC=CC=C1C=O |
| | BIS(2-FORMYLPHENYL) ETHER Usage And Synthesis |
| Uses | bis(2-Formylphenyl) Ether can be useful in the preparation of cyclic and acyclic ethers via silver triflimide-catalyzed intramol. reductive cross-coupling of aldehydes. |
| | BIS(2-FORMYLPHENYL) ETHER Preparation Products And Raw materials |
|