|
|
| | 5-CHLORO-2,4-DIFLUOROBENZOIC ACID Basic information |
| | 5-CHLORO-2,4-DIFLUOROBENZOIC ACID Chemical Properties |
| Melting point | 126-128° | | Boiling point | 272.6±35.0 °C(Predicted) | | density | 1.573±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.84±0.10(Predicted) | | form | powder | | color | White | | InChI | InChI=1S/C7H3ClF2O2/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2H,(H,11,12) | | InChIKey | VXBQLSVFGIFOPQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(Cl)=C(F)C=C1F | | CAS DataBase Reference | 130025-33-1(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-CHLORO-2,4-DIFLUOROBENZOIC ACID Usage And Synthesis |
| Chemical Properties | Off-white powder |
| | 5-CHLORO-2,4-DIFLUOROBENZOIC ACID Preparation Products And Raw materials |
|