|
|
| | 3-bromo-2-hydroxy-5-methylbenzoic acid Basic information |
| | 3-bromo-2-hydroxy-5-methylbenzoic acid Chemical Properties |
| Melting point | 227 °C(Solv: methanol (67-56-1)) | | Boiling point | 313.3±42.0 °C(Predicted) | | density | 1.739±0.06 g/cm3(Predicted) | | pka | 2.65±0.14(Predicted) | | form | solid | | InChI | 1S/C8H7BrO3/c1-4-2-5(8(11)12)7(10)6(9)3-4/h2-3,10H,1H3,(H,11,12) | | InChIKey | POGDQQPHOPNJFP-UHFFFAOYSA-N | | SMILES | CC1=CC(Br)=C(C(C(O)=O)=C1)O |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-bromo-2-hydroxy-5-methylbenzoic acid Usage And Synthesis |
| | 3-bromo-2-hydroxy-5-methylbenzoic acid Preparation Products And Raw materials |
|