- Fmoc-Trp-OH
-
- $0.00 / 25Kg/Drum
-
2026-05-19
- CAS:35737-15-6
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
- Fmoc-L-Trp-OH
-
- $0.00/ kg
-
2026-05-19
- CAS:35737-15-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | Nalpha-FMOC-L-Tryptophan Basic information |
| | Nalpha-FMOC-L-Tryptophan Chemical Properties |
| Melting point | 182-185 °C(lit.) | | alpha | -29 º (c=1,DMF) | | Boiling point | 541.92°C (rough estimate) | | density | 1.2501 (rough estimate) | | refractive index | -28.5 ° (C=1, DMF) | | storage temp. | 2-8°C | | solubility | almost transparency in Pyridine | | pka | 3.89±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D 29±1°, c = 1% in DMF | | BRN | 4216624 | | Major Application | peptide synthesis | | InChIKey | MGHMWKZOLAAOTD-DEOSSOPVSA-N | | SMILES | C(O)(=O)[C@H](CC1C2=C(C=CC=C2)NC=1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 35737-15-6(CAS DataBase Reference) |
| | Nalpha-FMOC-L-Tryptophan Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Nα-Fmoc-L-tryptophan is an N-Fmoc protected form of L-Tryptophan (T947210). L-Tryptophan is an essential amino acid that is important for cell proliferation and the biosynthesis of proteins. It is a precursor to Serotonin (HCl: S274980), a neurotransmitter that compound that aids in sleep and mental state. L-Tryptophan is also thought to cause eosinophilia-myalgia syndrome. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Nalpha-FMOC-L-Tryptophan Preparation Products And Raw materials |
|