| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | N-Acetyl-3-mercapto-D-valine Basic information |
| | N-Acetyl-3-mercapto-D-valine Chemical Properties |
| Melting point | 185-190 °C (dec.) | | Boiling point | 392.7±37.0 °C(Predicted) | | density | 1.201±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Ethanol (Slightly), Methanol (Slightly), Trifluoroacetic Acid (Slightly) | | form | Solid | | pka | 3.39±0.10(Predicted) | | color | White to Off-White | | Optical Rotation | [α]20/D +10±2°, c = 1% in ethanol | | Merck | 13,100 | | BRN | 1724742 | | Major Application | peptide synthesis | | InChI | 1S/C7H13NO3S/c1-4(9)8-5(6(10)11)7(2,3)12/h5,12H,1-3H3,(H,8,9)(H,10,11)/t5-/m0/s1 | | InChIKey | MNNBCKASUFBXCO-YFKPBYRVSA-N | | SMILES | CC(=O)N[C@@H](C(O)=O)C(C)(C)S || CC(=O)N[C@@H](C(O)=O)C(C)(C)S |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-23 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N-Acetyl-3-mercapto-D-valine Usage And Synthesis |
| Uses | Protected Penicillamin. | | Definition | ChEBI: An N-acetyl-D-amino acid where the amino acid is D-penicillamine | | Biological Activity | N-Acetyl-D-penicillamine (NAP or NAPA), a thiol compound, is often used as a control molecule in studies involving nitric oxide donor molecules such as S-nitroso-N-acetyl-dl-penicillamine (SNAP) and sodium nitroprusside (SNP). N-acetyl-D-penicillamine (NAPA) is also used as a heavy metal chelator. | | Purification Methods | Both forms are recrystallised from hot H2O. A pure sample of the D-form is obtained after five recrystallisations. [Crooks in The Chemistry of Penicillin Clarke, Johnson and Robinson eds, Princeton University Press, 470 1949, Review: Chain et al. Antibiotics (Oxford University Press) 2 1949, Beilstein 4 III 1662.] |
| | N-Acetyl-3-mercapto-D-valine Preparation Products And Raw materials |
|