|
|
| | 2,6-Dichloro-1-fluoropyridinium triflate Basic information |
| | 2,6-Dichloro-1-fluoropyridinium triflate Chemical Properties |
| Melting point | 176-182 °C | | storage temp. | 2-8°C | | form | Powder | | color | white to light-yellow | | Sensitive | air sensitive, moisture sensitive, store cold | | InChI | InChI=1S/C5H3Cl2FN.CHF3O3S/c6-4-2-1-3-5(7)9(4)8;2-1(3,4)8(5,6)7/h1-3H;(H,5,6,7)/q+1;/p-1 | | InChIKey | KDFRVNARKRKXQQ-UHFFFAOYSA-M | | SMILES | C(F)(F)(F)S([O-])(=O)=O.[N+]1(F)C(Cl)=CC=CC=1Cl | | CAS DataBase Reference | 130433-68-0(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-35 | | Safety Statements | 45-36/37/39-26 | | RIDADR | UN 3261 8 / PGII | | WGK Germany | 3 | | TSCA | No | | HazardClass | IRRITANT | | HS Code | 29333999 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| Provider | Language |
|
ACROS
| English |
| | 2,6-Dichloro-1-fluoropyridinium triflate Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | 2,6-Dichloro-1-fluoropyridinium triflate can be used in the fluorination of various organic compounds. | | Uses | N-fluoropyridinium triflate salts offer a tunable fluorinating system; electronic nature of the substituents on the ring dictates the potency and selectivity of the reagent. Efficient fluorination of various aromatics, carbanions, vinyl esters, alkyls, and enamines. | | Uses | - Used in the fluorination of various organic compounds
- Fluoropyridinium triflates are versatile reagents for transformation of thioglycosides into ο-glycoside, glycosyl azide and sulfoxide
- Electrolytic partial fluorination and diastereoselective anodic fluorination
- Regioselective, electrochemical fluorination
- Fluorination of alkenes with N-F type of reagents
|
| | 2,6-Dichloro-1-fluoropyridinium triflate Preparation Products And Raw materials |
|