|
|
| | (2,2'-BIPYRIDINE)DICHLOROPALLADIUM(II) Basic information |
| Product Name: | (2,2'-BIPYRIDINE)DICHLOROPALLADIUM(II) | | Synonyms: | (2,2'-BIPYRIDINE)DICHLOROPALLADIUM(II);Dichloro(2;(2,2'-Bipyridine)dichloropalladium;2,2'-Bipyridylpalladium dichloride;Bis(2,2'-bipyridine)palladium dichloride;cis-(2,2'-Bipyridine)dichloropalladium;Dichloro(2,2'-bipyridine)palladium;Palladium,(2,2'-bipyridine-kN1,kN1')dichloro-, (SP-4-2)- | | CAS: | 14871-92-2 | | MF: | C10H8Cl2N2Pd | | MW: | 333.51 | | EINECS: | | | Product Categories: | Pd;Homogeneous Pd Catalysts;Catalysis and Inorganic Chemistry;Palladium | | Mol File: | 14871-92-2.mol |  |
| | (2,2'-BIPYRIDINE)DICHLOROPALLADIUM(II) Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C10H8N2.2ClH.Pd/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;/h1-8H;2*1H;/q;;;+2/p-2 | | InChIKey | MUNARLQNCCGPQU-UHFFFAOYSA-L | | SMILES | C1(C2N=CC=CC=2)=NC=CC=C1.[Pd](Cl)Cl |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (2,2'-BIPYRIDINE)DICHLOROPALLADIUM(II) Usage And Synthesis |
| reaction suitability | core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | (2,2'-BIPYRIDINE)DICHLOROPALLADIUM(II) Preparation Products And Raw materials |
|