- 11-DODECENOIC ACID
-
- $1.10 / 1g
-
2025-11-18
- CAS:65423-25-8
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
|
| | 11-DODECENOIC ACID Basic information |
| | 11-DODECENOIC ACID Chemical Properties |
| Melting point | 20°C | | Boiling point | 321.28°C (estimate) | | density | 0.9014 | | FEMA | 4355 | 11-DODECENOIC ACID | | refractive index | 1.4510 | | pka | 4.78±0.10(Predicted) | | form | Liquid | | Odor | at 10.00 % in dipropylene glycol. fatty citrus aldehydic | | Odor Type | fatty | | JECFA Number | 1635 | | InChI | InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2H,1,3-11H2,(H,13,14) | | InChIKey | GZZPOFFXKUVNSW-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCCCCCC=C | | LogP | 4.52 |
| | 11-DODECENOIC ACID Usage And Synthesis |
| Chemical Properties | Colorless liquid; fatty, citrusy aroma. | | Uses | 11-Dodecenoic acid (Dodec-11-enoic acid) is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | | Definition | ChEBI: Dodec-11-enoic acid is a dodecenoic acid. | | Synthesis Reference(s) | Journal of the American Chemical Society, 112, p. 3717, 1990 DOI: 10.1021/ja00165a098 |
| | 11-DODECENOIC ACID Preparation Products And Raw materials |
|