|
|
| | Bis(2-oxo-3-oxazolidinyl)phosphinic chloride Basic information |
| | Bis(2-oxo-3-oxazolidinyl)phosphinic chloride Chemical Properties |
| Melting point | 191 °C (dec.)(lit.) | | Boiling point | 332.8±25.0 °C(Predicted) | | density | 1.71±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | slightly sol CH2Cl2, MeCN, THF, DMF; dec H2O | | pka | -2.47±0.20(Predicted) | | form | Crystalline Powder | | color | White to off-white | | Water Solubility | Hydrolyzes with water. | | Sensitive | Moisture Sensitive | | BRN | 3654596 | | InChI | InChI=1S/C6H8ClN2O5P/c7-15(12,8-1-3-13-5(8)10)9-2-4-14-6(9)11/h1-4H2 | | InChIKey | KLDLRDSRCMJKGM-UHFFFAOYSA-N | | SMILES | P(N1CCOC1=O)(N1CCOC1=O)(Cl)=O | | CAS DataBase Reference | 68641-49-6(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | SZ5871000 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29349990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Bis(2-oxo-3-oxazolidinyl)phosphinic chloride Usage And Synthesis |
| Description | Bis(2-oxo-3-oxazolidinyl)phosphinic chloride is a reagent for activating carboxyl groups, converting acids to esters (including thioesters and phosphoesters), amides (including peptides and β-lactams), and anhydrides; reagent for kinetic resolution of racemic carboxylic acids and alcohols. | | Chemical Properties | White solid | | Uses | Bis(2-oxo-3-oxazolidinyl)phosphinic chloride was used in the preparation of hexadepsipeptide. | | storage | Bis(2-oxo-3-oxazolidinyl)phosphinic chloride should store in a cool dry place under nitrogen to preclude contact with moisture and oxygen. Use only in a chemical fume hood. Wear suitable protective clothing and eye/face protection. Causes burns and is harmful if swallowed, inhaled, or absorbed through skin. | | Purification Methods | the outcome of reactions can be greatly affected by the purity of the reagent; commercial samples may require to be washed with cold water and recrystallized from MeCN prior to use. |
| | Bis(2-oxo-3-oxazolidinyl)phosphinic chloride Preparation Products And Raw materials |
|