| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Products Intro: |
Product Name:2,3,5,6,8,9,11,12,14,15-Decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecin-18-amine
CAS:68941-06-0
Remarks:Please reach out to us for more information about custom solutions.
|
|
|
|
|
|
| Product Name: | 4'-Aminobenzo-18-crown-6 | | Synonyms: | 4-AMINOBENZO-18-CROWN-6 SESQUIHYDRATE HYDROCHLORIDE;2,3,5,6,8,9,11,12,14,15-DECAHYDRO-1,4,7,10,13,16-BENZOHEXAOXACYCLOOCTADECIN-18-AMINE;2,3,5,6,8,9,11,12,14,15-DECAHYDRO-1,4,7,10,13,16-BENZOHEXAOXXACYCLO-OCTADECIN-18-AMINE HYDROCHLORIDE;(BENZO-18-CROWN-6)-4'-YLAMINE;2,3,5,6,8,9,11,12,14,15-Decahydro-1,4,7,10,13,16-benzohexaox;4-AMINOBENZO-18-CROWN-6 PURUM,97%;2,3,5,6,8,9,11,12,14,15-decahydrobenzo[b][1,4,7,10,13,16]hexaoxacyclooctadecin-18-aMine;4'-AMinobenzo-18-crown-6 technical | | CAS: | 68941-06-0 | | MF: | C16H25NO6 | | MW: | 327.37 | | EINECS: | | | Product Categories: | | | Mol File: | 68941-06-0.mol |  |
| | 4'-Aminobenzo-18-crown-6 Chemical Properties |
| Melting point | 53-56 °C | | Boiling point | 511.9±50.0 °C(Predicted) | | density | 1.099±0.06 g/cm3(Predicted) | | storage temp. | 0-6°C | | pka | 4.62±0.20(Predicted) | | Appearance | Light brown to brown Solid | | BRN | 5296463 | | InChI | InChI=1S/C16H25NO6/c17-14-1-2-15-16(13-14)23-12-10-21-8-6-19-4-3-18-5-7-20-9-11-22-15/h1-2,13H,3-12,17H2 | | InChIKey | PZXYILUXRGTFGD-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(N)C=C2OCCOCCOCCOCCOCC1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4'-Aminobenzo-18-crown-6 Usage And Synthesis |
| Application | 4'-Aminobenzo-18-crown ether-6 is a crown ether compound used as a catalyst in organic synthesis reactions. | | Description |
4′-Aminophenyl-18-crown-6 is a cyclic compound. It is widely used as an ion carrier. It coordinates to metal ions more easily than other ligands because its planar oxygen atoms provide a strong negative potential barrier. 4'-aminobenzo-18-Crown-6 (AB18C6) could be used to design and fabricate a novel magnetic absorbent for absorption and determination of lead metal ion (Pb2+) based on a self-assembly approach via the dehydration condensation[1].
| | References |
[1] yan Jing-Kang et al. “4′-Aminobenzo-18-crown-6 functionalized magnetic nanoparticles as a solid-phase extraction adsorbent for the determination of Pb2+.” Analytical Methods 13 (2019): 1735–1742.
|
| | 4'-Aminobenzo-18-crown-6 Preparation Products And Raw materials |
|