N-LAURYLDIETHANOLAMINE manufacturers
- N-Lauryldiethanolamine
-
- $8.80 / 500kg
-
2026-04-17
- CAS:1541-67-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 500kg
|
| | N-LAURYLDIETHANOLAMINE Basic information |
| Product Name: | N-LAURYLDIETHANOLAMINE | | Synonyms: | 2,2'-(Dodecylimino)diethanol;2,2'-(Laurylimino)diethanol;2,2’-(dodecylimino)bis-ethano;N-Lauryldiethanolamine 1541-67-9;2,2’-(dodecylimino)bis-Ethanol;Ethanol,2,2'-(dodecylimino)bis-;2,2'-(dodecylimino)bis-Ethanol Lauryldiethanolamine;PEG-2 Laurylamine (Antistatic agent B1) | | CAS: | 1541-67-9 | | MF: | C16H35NO2 | | MW: | 273.45 | | EINECS: | 216-277-8 | | Product Categories: | | | Mol File: | 1541-67-9.mol |  |
| | N-LAURYLDIETHANOLAMINE Chemical Properties |
| Melting point | 185-190℃ | | Boiling point | 195°C/3mmHg(lit.) | | density | 0.92 | | refractive index | 1.4675 (589.3 nm 20℃) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 14.41±0.10(Predicted) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C16H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-17(13-15-18)14-16-19/h18-19H,2-16H2,1H3 | | InChIKey | NKFNBVMJTSYZDV-UHFFFAOYSA-N | | SMILES | N(CCO)(CCO)CCCCCCCCCCCC | | EPA Substance Registry System | Lauryldiethanolamine (1541-67-9) |
| | N-LAURYLDIETHANOLAMINE Usage And Synthesis |
| Uses | N-Lauryldiethanolamine has a wide range of applications including use as an additive in polymers, pharmaceuticals and cosmetics. N-Lauryldiethanolamine is also used in sample preparation as it can be used to remove cations from samples. It is also used as a cationic surfactant which helps to disperse particles in liquid systems. Fourier Transform Infrared Spectroscopy can be used to identify hydrogen bonding interactions between hydroxyl groups and nitrogen atoms in this product. |
| | N-LAURYLDIETHANOLAMINE Preparation Products And Raw materials |
|