|
|
| | 3-(4-Methylphenyl)-1-(2,4,6-trimethoxyphenyl)-2-propen-1-one Basic information |
| Product Name: | 3-(4-Methylphenyl)-1-(2,4,6-trimethoxyphenyl)-2-propen-1-one | | Synonyms: | 4-METHYL-2',4',6'-TRIMETHOXYCHALCONE;2-Propen-1-one, 3-(4-methylphenyl)-1-(2,4,6-trimethoxyphenyl)-, (2E)-;(2E)-3-(4-Methylphenyl)-1-(2,4,6-trimethoxyphenyl)-2-propen-1-one;3-(4-Methylphenyl)-1-(2,4,6-trimethoxyphenyl)-2-propen-1-one | | CAS: | 1017899-30-7 | | MF: | C19H20O4 | | MW: | 312.36 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 3-(4-Methylphenyl)-1-(2,4,6-trimethoxyphenyl)-2-propen-1-one Chemical Properties |
| Melting point | 118-119 °C | | Boiling point | 491.554±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.123±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | InChI | 1S/C19H20O4/c1-13-5-7-14(8-6-13)9-10-16(20)19-17(22-3)11-15(21-2)12-18(19)23-4/h5-12H,1-4H3/b10-9+ | | InChIKey | WHMKGWDMDYPXRP-MDZDMXLPSA-N | | SMILES | COc1cc(OC)c(C(=O)\C=C\c2ccc(C)cc2)c(OC)c1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-(4-Methylphenyl)-1-(2,4,6-trimethoxyphenyl)-2-propen-1-one Usage And Synthesis |
| | 3-(4-Methylphenyl)-1-(2,4,6-trimethoxyphenyl)-2-propen-1-one Preparation Products And Raw materials |
|