| Company Name: |
Biosyn Research Chemicals
|
| Tel: |
+91-91-9346022300 +91-9346022300 |
| Email: |
info@biosyn.in |
| Products Intro: |
Product Name:4-Methyl-2',4',6'-trimethoxychalcone
CAS:1017899-30-7
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:4-Methyl-2′,4′,6′-trimethoxychalcone
|
| Company Name: |
Biosyn Research Chemicals
|
| Tel: |
+91 9346022300/+91 9399339999 |
| Email: |
info@biosyn.in |
| Products Intro: |
Product Name:4-Methyl-2',4',6'-trimethoxychalcone
CAS:1017899-30-7
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Purity:AldrichCPR
|
|
| | 3-(4-METHYLPHENYL)-1-(2,4,6-TRIMETHOXYPHENYL)-2-PROPEN-1-ONE Basic information |
| Product Name: | 3-(4-METHYLPHENYL)-1-(2,4,6-TRIMETHOXYPHENYL)-2-PROPEN-1-ONE | | Synonyms: | 3-(4-METHYLPHENYL)-1-(2,4,6-TRIMETHOXYPHENYL)-2-PROPEN-1-ONE;4-METHYL-2',4',6'-TRIMETHOXYCHALCONE;2-Propen-1-one, 3-(4-methylphenyl)-1-(2,4,6-trimethoxyphenyl)-, (2E)-;(2E)-3-(4-Methylphenyl)-1-(2,4,6-trimethoxyphenyl)-2-propen-1-one | | CAS: | 1017899-30-7 | | MF: | C19H20O4 | | MW: | 312.36 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 3-(4-METHYLPHENYL)-1-(2,4,6-TRIMETHOXYPHENYL)-2-PROPEN-1-ONE Chemical Properties |
| form | solid | | InChI | 1S/C19H20O4/c1-13-5-7-14(8-6-13)9-10-16(20)19-17(22-3)11-15(21-2)12-18(19)23-4/h5-12H,1-4H3/b10-9+ | | InChIKey | WHMKGWDMDYPXRP-MDZDMXLPSA-N | | SMILES | COc1cc(OC)c(C(=O)\C=C\c2ccc(C)cc2)c(OC)c1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-(4-METHYLPHENYL)-1-(2,4,6-TRIMETHOXYPHENYL)-2-PROPEN-1-ONE Usage And Synthesis |
| | 3-(4-METHYLPHENYL)-1-(2,4,6-TRIMETHOXYPHENYL)-2-PROPEN-1-ONE Preparation Products And Raw materials |
|