|
|
| | 2,4-Diphenyl-4-methyl-1-pentene Basic information |
| Product Name: | 2,4-Diphenyl-4-methyl-1-pentene | | Synonyms: | Benzene,1,1'-(1,1-dimethyl-3-methylene-1,3-propanediyl)bis-;Alpha Methyls styrene diMer;2,4-Diphenyl-4-Methyl-1-pentene 97%;1,1’-(1,1-dimethyl-3-methylene-1,3-propanediyl)bis-benzen;1,1’-(1,1-dimethyl-3-methylene-1,3-propanediyl)bis-Benzene;ALPHA METHYLSTYRENE DIMER;2,4-DIPHENYL-4-METHYL-1-PENTENE;2,4-DIPHENYL-4-METHYLPENTENE-1 | | CAS: | 6362-80-7 | | MF: | C18H20 | | MW: | 236.35 | | EINECS: | 228-846-8 | | Product Categories: | | | Mol File: | 6362-80-7.mol |  |
| | 2,4-Diphenyl-4-methyl-1-pentene Chemical Properties |
| Boiling point | 161 °C/5 mmHg (lit.) | | density | 0.99 g/mL at 25 °C (lit.) | | vapor pressure | 0.063Pa at 25℃ | | refractive index | 1.569 | | Fp | 160°C | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | 24.75ug/L(temperature not stated) | | InChI | InChI=1S/C18H20/c1-15(16-10-6-4-7-11-16)14-18(2,3)17-12-8-5-9-13-17/h4-13H,1,14H2,2-3H3 | | InChIKey | ZOKCNEIWFQCSCM-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(C)(C)CC(C1=CC=CC=C1)=C | | LogP | 6.2 at 25℃ | | CAS DataBase Reference | 6362-80-7(CAS DataBase Reference) | | EPA Substance Registry System | 4-Methyl-2,4-diphenyl-1-pentene (6362-80-7) |
| Hazard Codes | Xi,N,T | | Risk Statements | 36/37/38-36/37-50/53-48/25-43-22 | | Safety Statements | 26-36-61-60-36/37 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 3 | | Autoignition Temperature | 375℃ | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29029090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 STOT RE 2 |
| | 2,4-Diphenyl-4-methyl-1-pentene Usage And Synthesis |
| Uses | Nofmer MSD is chain transfer agent; is used in preparation of Polyvinyl Acetate. | | Flammability and Explosibility | Non flammable |
| | 2,4-Diphenyl-4-methyl-1-pentene Preparation Products And Raw materials |
|