|
|
| | Potassium 3-sulphonatopropyl acrylate Basic information |
| | Potassium 3-sulphonatopropyl acrylate Chemical Properties |
| Melting point | 302°C (dec.) | | vapor pressure | 0.01Pa at 20℃ | | storage temp. | 2-8°C, sealed storage, away from moisture | | Water Solubility | Soluble in water | | form | powder to crystal | | color | White to Almost white | | Cosmetics Ingredients Functions | HAIR CONDITIONING | | InChI | 1S/C6H10O5S.K/c1-2-6(7)11-4-3-5-12(8,9)10;/h2H,1,3-5H2,(H,8,9,10);/q;+1/p-1 | | InChIKey | VSFOXJWBPGONDR-UHFFFAOYSA-M | | SMILES | [K+].[O-]S(=O)(=O)CCCOC(=O)C=C | | LogP | -3.63 at 21.5℃ | | EPA Substance Registry System | 2-Propenoic acid, 3-sulfopropyl ester, potassium salt (31098-20-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-37/39 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 3504009000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | DEA Controlled Substances | CSCN: 1635
CAS SCH: IV
NARC: N |
| | Potassium 3-sulphonatopropyl acrylate Usage And Synthesis |
| Uses | The monomer was polymerized to prepare a hydrogel test bed, which was used in a study an in vitro wound infection model. It was polymerized with N-isopropyl acrylamide to prepare thermoresponsive super water absorbent hydrogels, superporous hydrogels (SPH) and SPH based composites. | | Flammability and Explosibility | Non flammable |
| | Potassium 3-sulphonatopropyl acrylate Preparation Products And Raw materials |
|