| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Aminophthalic acid hydrochloride Basic information |
| Product Name: | 3-Aminophthalic acid hydrochloride | | Synonyms: | 2-benzenedicarboxylicacid,3-amino-hydrochloride;3-AMINO-1,2-BENZENEDICARBOXYLIC ACID HYDROCHLORIDE;3-Aminophthalic acid HCL;3-AminophthalicacidHClhydrate;3-Aminophthalicacidhydrochloridelhydrate;3-AMINOPHTHALIC ACID HYDROCHLORIDE 1-HYDRATE;3-aminobenzene-1,2-dicarboxylic acid hydrochloride;3-AMINOPHTHALIC ACID HYDROCHLORIDE 98% | | CAS: | 6946-22-1 | | MF: | C8H8ClNO4 | | MW: | 217.61 | | EINECS: | 230-106-4 | | Product Categories: | Phthalic Acids, Esters and Derivatives | | Mol File: | 6946-22-1.mol |  |
| | 3-Aminophthalic acid hydrochloride Chemical Properties |
| Melting point | 182 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Very Slightly) | | form | Crystalline Powder | | color | Off-white to yellow-beige | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H7NO4.ClH/c9-5-3-1-2-4(7(10)11)6(5)8(12)13;/h1-3H,9H2,(H,10,11)(H,12,13);1H | | InChIKey | ZBZAVEORKXFUQB-UHFFFAOYSA-N | | SMILES | C1(C(=O)O)C(N)=CC=CC=1C(=O)O.Cl | | CAS DataBase Reference | 6946-22-1(CAS DataBase Reference) | | EPA Substance Registry System | 1,2-Benzenedicarboxylic acid, 3-amino-, hydrochloride (6946-22-1) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 24/25 | | TSCA | TSCA listed | | HS Code | 29242998 |
| Provider | Language |
|
ACROS
| English |
| | 3-Aminophthalic acid hydrochloride Usage And Synthesis |
| Chemical Properties | off-white to yellow-beige crystalline powder | | Uses | 3-Aminophthalic Acid Hydrochloride is a reactant used in the preparation of local anesthetics. | | Synthesis | The general procedure for the synthesis of 3-aminophthalic acid hydrochloride from 3-nitrophthalic acid was as follows: an ethanol solution (600 mL) of 3-nitrophthalic acid (100 g) and 10% Pd/C catalyst (3.2 g) was added to an autoclave. A hydrogen pressure of 4.0 kg was applied at 20-25 °C and the reaction was carried out for 3.0 hours. Upon completion of the reaction, the reaction mixture was cooled to 20 °C and filtered through a Hyflo bed. The filtrate was concentrated by distillation under reduced pressure and acetone was added to the residue. The mixture was cooled to 10 °C and concentrated hydrochloric acid was added slowly with continuous stirring. After removing the solvent under reduced pressure, acetonitrile was added. The mixture was again cooled to 10°C and the precipitated solid was filtered. Finally, the product was dried under vacuum at 45-50 °C for 6 h to give 3-aminophthalic acid hydrochloride (65.0 g). | | References | [1] Patent: US5103057, 1992, A [2] Patent: EP434145, 1991, A2 [3] Patent: WO2017/33116, 2017, A1. Location in patent: Paragraph 00114; 00132 [4] Patent: CN106986783, 2017, A. Location in patent: Paragraph 0008 |
| | 3-Aminophthalic acid hydrochloride Preparation Products And Raw materials |
|