- EATON'S REAGENT
-
- $1.00 / 1KG
-
2019-07-12
- CAS:39394-84-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 25kg
|
| | EATON'S REAGENT Basic information |
| | EATON'S REAGENT Chemical Properties |
| Boiling point | 122 °C/1 mmHg | | density | 1.5 g/mL at 25 °C | | refractive index | n20/D 1.435 | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid | | color | Clear | | Water Solubility | Decomposes in water. | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/CH4O3S.O5P2/c1-5(2,3)4;1-6(2)5-7(3)4/h1H3,(H,2,3,4); | | InChIKey | JHNLZOVBAQWGQU-UHFFFAOYSA-N | | SMILES | S(=O)(=O)(O)C.P(=O)(=O)OP(=O)=O |
| Hazard Codes | C | | Risk Statements | 34-21/22 | | Safety Statements | 23-26-36/37/39-45 | | RIDADR | UN 2922 8/PG 2 | | WGK Germany | 1 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 28112900 |
| | EATON'S REAGENT Usage And Synthesis |
| Chemical Properties | Clear colorless to light yellow liquid | | Uses | Eaton's Reagent is used in the synthesis fluorine-based hole-transporting material, mono and bis-chalcone derivatives via Claisen-Schmidt condensation reaction between arylaldehydes and ketones and 4-hydroxycoumarins and 4-hydroxy-2-quinolinones derivatives. | | Uses | Eaton′s Reagent may be used in the synthesis of the following:
- Fluorene-based hole-transporting material.
- Mono and bis-chalcone derivatives via Claisen-Schmidt condensation reaction between arylaldehydes and ketones.
- 4-Hydroxycoumarins and 4-hydroxy-2-quinolinones derivatives.
| | General Description | Eaton′s Reagent contains 7.7wt% phosphorus pentoxide in methanesulfonic acid. It is commonly used as a catalyst and condensing agent. |
| | EATON'S REAGENT Preparation Products And Raw materials |
|