- Fendizoic acid
-
- $0.00 / 1kg
-
2025-04-04
- CAS:84627-04-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
- fendizoic acid
-
- $0.00 / 1Kg
-
2024-12-24
- CAS:84627-04-3
- Min. Order: 1Kg
- Purity: 99.9%
- Supply Ability: 200tons
- Fendizoic acid
-
- $583.00 / 25kg
-
2023-07-10
- CAS:84627-04-3
- Min. Order: 25kg
- Purity: 99%
- Supply Ability: 1000kg
|
| Product Name: | Fendizoic acid | | Synonyms: | Bis(Triphenylphosphineiminium Chloride C36H30Clnp2;Levocloperastine Fendizoic Acid Intermediate;2-(6-HYDROXY-BIPHENYL-3-CARBONYL)-BENZOIC ACID;2-[(6-Hydroxy[1,1'-biphenyl]-3-yl)carbonyl]benzoic acid;Fendizoic acid;LEVOCLOPERASTINE IMPURITY;Levocloperastine IMpurity-Fendizoic Acid;Levocloperastine Fendizoic Acid Impurity | | CAS: | 84627-04-3 | | MF: | C20H14O4 | | MW: | 318.32 | | EINECS: | | | Product Categories: | | | Mol File: | 84627-04-3.mol |  |
| | Fendizoic acid Chemical Properties |
| Melting point | 262-264 °C | | Boiling point | 593.9±50.0 °C(Predicted) | | density | 1.305 | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 3.28±0.36(Predicted) | | color | White to Pale Yellow | | InChI | InChI=1S/C20H14O4/c21-18-11-10-14(12-17(18)13-6-2-1-3-7-13)19(22)15-8-4-5-9-16(15)20(23)24/h1-12,21H,(H,23,24) | | InChIKey | PKHPZNKXOBWFCX-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1C(C1C=CC(O)=C(C2=CC=CC=C2)C=1)=O |
| | Fendizoic acid Usage And Synthesis |
| Physical Form | Powder | | Uses | Fendizoic Acid is a reagent in the synthesis of fluorinated polyphthalazinone ethers containing perfluorophenylene moieties. |
| | Fendizoic acid Preparation Products And Raw materials |
|