|
|
| | Methyl p-tert-butylphenylacetate Basic information |
| | Methyl p-tert-butylphenylacetate Chemical Properties |
| Boiling point | 106 °C/2 mmHg (lit.) | | density | 0.999 g/mL at 25 °C (lit.) | | FEMA | 2690 | METHYL P-TERT-BUTYLPHENYLACETATE | | refractive index | n20/D 1.501(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Colourless to light yellow | | Odor | at 100.00 %. dairy buttermilk leafy creamy green waxy fatty hyacinth melon rind rubbery | | Odor Type | dairy | | biological source | synthetic | | JECFA Number | 1025 | | BRN | 2502880 | | Major Application | flavors and fragrances | | InChI | 1S/C13H18O2/c1-13(2,3)11-7-5-10(6-8-11)9-12(14)15-4/h5-8H,9H2,1-4H3 | | InChIKey | HXVTYMWVMVKVTF-UHFFFAOYSA-N | | SMILES | COC(=O)Cc1ccc(cc1)C(C)(C)C | | LogP | 3.65 | | CAS DataBase Reference | 3549-23-3(CAS DataBase Reference) | | EPA Substance Registry System | Benzeneacetic acid, 4-(1,1-dimethylethyl)-, methyl ester (3549-23-3) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29163990 | | Storage Class | 10 - Combustible liquids |
| | Methyl p-tert-butylphenylacetate Usage And Synthesis |
| Description | Methyl p-tert-butylphenylacetate has a sweet, woody, and camphoraceous odor with a roasted, chocolate-like flavor. May be
prepared by esterification of p-tert-butylphenylacetic acid with
methanol. | | Chemical Properties | Methyl p-tert-butylphenylacetate has a sweet, woody and camphoraceous odor and a roasted, chocolate-like flavor. | | Preparation | By esterification of p-tert-butylphenylacetic acid with methanol | | Aroma threshold values | Aroma characteristics at 1.0%: musty meaty, chicken fatty, cocoa honey, floral, sour, fatty milky, dairy
and fishy nuances. | | Taste threshold values | Taste characteristics at 5 ppm: leafy, green, waxy and honey-like, sweet cocoa, buttery creamy, fatty milky
dairy-like with fishy and fruity nuances | | General Description | Methyl p-tert-butylphenylacetate can be used as a food flavoring agent. |
| | Methyl p-tert-butylphenylacetate Preparation Products And Raw materials |
|