| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Methyl 2-bromothiazole-5-carboxylate Basic information |
| | Methyl 2-bromothiazole-5-carboxylate Chemical Properties |
| Melting point | 78-80°C | | Boiling point | 263.3±13.0 °C(Predicted) | | density | 1.759±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | -1.09±0.10(Predicted) | | color | White to Yellow to Orange | | InChI | InChI=1S/C5H4BrNO2S/c1-9-4(8)3-2-7-5(6)10-3/h2H,1H3 | | InChIKey | HNLVIKMXFBRZDF-UHFFFAOYSA-N | | SMILES | S1C(C(OC)=O)=CN=C1Br | | CAS DataBase Reference | 54045-74-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HS Code | 29341000 | | Storage Class | 11 - Combustible Solids |
| | Methyl 2-bromothiazole-5-carboxylate Usage And Synthesis |
| Chemical Properties | Solid | | Uses | Methyl 2-Bromothiazole-5-carboxylate is used as a reagent to prepare thiazole derivatives that inhibit stearoyl-CoA desaturase and may be a new treatment for obesity, type-2 diabetes and other metabolic disorders. |
| | Methyl 2-bromothiazole-5-carboxylate Preparation Products And Raw materials |
|