|
|
| | O-(Tert-Butyldimethylsilyl)Benzanilide Basic information |
| | O-(Tert-Butyldimethylsilyl)Benzanilide Chemical Properties |
| Melting point | 71 °C | | Boiling point | 373.3±25.0 °C(Predicted) | | density | 0.93±0.1 g/cm3(Predicted) | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 2.31±0.50(Predicted) | | color | White to Almost white | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C19H25NOSi/c1-19(2,3)22(4,5)21-18(16-12-8-6-9-13-16)20-17-14-10-7-11-15-17/h6-15H,1-5H3 | | InChIKey | CQKWSHDUCPVOAI-UHFFFAOYSA-N | | SMILES | C1(C(=NC2=CC=CC=C2)O[Si](C(C)(C)C)(C)C)=CC=CC=C1 |
| | O-(Tert-Butyldimethylsilyl)Benzanilide Usage And Synthesis |
| Uses | Tert-Butyldimethylsilyl N-Phenylbenzimidate is a catalyst that can be used for the efficient silylation of alcohols. This catalytic compound is highly efficient and has been shown to promote the reaction in a sterically demanding environment.
|
| | O-(Tert-Butyldimethylsilyl)Benzanilide Preparation Products And Raw materials |
|