|
|
| | CHEMBRDG-BB 4015553 Basic information |
| Product Name: | CHEMBRDG-BB 4015553 | | Synonyms: | CHEMBRDG-BB 4015553;[4-(1-Piperidin-1-ylethyl)phenyl]boronic acid;Boronic acid, B-[4-[1-(1-piperidinyl)ethyl]phenyl]- | | CAS: | 1287753-40-5 | | MF: | C13H20BNO2 | | MW: | 233.11 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | CHEMBRDG-BB 4015553 Chemical Properties |
| Boiling point | 370.3±44.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | form | solid | | pka | 8.51±0.17(Predicted) | | InChI | 1S/C13H20BNO2/c1-11(15-9-3-2-4-10-15)12-5-7-13(8-6-12)14(16)17/h5-8,11,16-17H,2-4,9-10H2,1H3 | | InChIKey | AAVZQQFWPJUBCQ-UHFFFAOYSA-N | | SMILES | CC(N1CCCCC1)c2ccc(cc2)B(O)O |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | CHEMBRDG-BB 4015553 Usage And Synthesis |
| | CHEMBRDG-BB 4015553 Preparation Products And Raw materials |
|