- FRANGULIN B
-
- $2.00 / 1KG
-
2019-07-06
- CAS:14101-04-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 10000kg
|
| | FRANGULIN B Basic information |
| Product Name: | FRANGULIN B | | Synonyms: | EMODIN-6-(L)-O-APIOSIDE;EMODIN-L-RHAMNOSIDE;EMODIN-6-O-APIOSIDE;FRANGULIN B;RAHMNOXANTHIN;3-(D-apio-.betascsc.-furanosyloxy)-1,8-dihydroxy-6-methylanthraquinone;3-(D-Apio-β-D-furanosyloxy)-1,8-dihydroxy-6-methyl-9,10-anthracenedione;3-(D-Apio-beta-D-furanosyloxy)-1,8-dihydroxy-6-methylanthraquinone | | CAS: | 14101-04-3 | | MF: | C20H18O9 | | MW: | 402.35 | | EINECS: | 237-953-9 | | Product Categories: | Anthraquinones, Hydroquinones and Quinones | | Mol File: | 14101-04-3.mol |  |
| | FRANGULIN B Chemical Properties |
| Melting point | 196℃ | | Boiling point | 774.6±60.0 °C(Predicted) | | density | 1.655±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | pka | 6.01±0.20(Predicted) | | form | powder | | InChI | 1S/C20H18O9/c1-8-2-10-14(12(22)3-8)17(25)15-11(16(10)24)4-9(5-13(15)23)29-19-18(26)20(27,6-21)7-28-19/h2-5,18-19,21-23,26-27H,6-7H2,1H3/t18-,19-,20+/m0/s1 | | InChIKey | AEQMIFRODRFTJF-SLFFLAALSA-N | | SMILES | OC[C@]1(O)[C@@H](O)[C@@H](OC1)OC2=CC(O)=C3C(C(C(C=C(C)C=C4O)=C4C3=O)=O)=C2 | | LogP | 3.660 (est) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | FRANGULIN B Usage And Synthesis |
| Uses | Frangulin B is an anthraquinone derivative that has been investigated for having anti-inflammatory effects, and as a natural product from Formosan plants acting as an Inhibitor of DNA Methyltransferase. | | Definition | ChEBI: Frangulin B is an anthraquinone. |
| | FRANGULIN B Preparation Products And Raw materials |
|