|
|
| | 4-Methoxybenzoylacetonitrile Basic information | | Uses |
| | 4-Methoxybenzoylacetonitrile Chemical Properties |
| Melting point | 129-132 °C | | Boiling point | 364.4±22.0 °C(Predicted) | | density | 1.131±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | Crystalline Powder | | pka | 8.27±0.10(Predicted) | | color | Yellow | | BRN | 743909 | | InChI | InChI=1S/C10H9NO2/c1-13-9-4-2-8(3-5-9)10(12)6-7-11/h2-5H,6H2,1H3 | | InChIKey | IKEPUFCALLUUBC-UHFFFAOYSA-N | | SMILES | C1(C=CC(OC)=CC=1)C(=O)CC#N | | CAS DataBase Reference | 3672-47-7(CAS DataBase Reference) |
| | 4-Methoxybenzoylacetonitrile Usage And Synthesis |
| Uses | 4-Methoxybenzoylacetonitrile is a nitrile derivative used in organic synthesis, scientific research, and as a chemical reagent. | | Chemical Properties | yellow crystalline powder |
| | 4-Methoxybenzoylacetonitrile Preparation Products And Raw materials |
|