- Hordenine hydrochloride
-
- $50.00 / 1kg
-
2026-04-01
- CAS:6027-23-2
- Min. Order: 1kg
- Purity: 98% 99%
- Supply Ability: 100000
- Hordenine hydrochloride
-
- $0.10 / 1KG
-
2025-12-24
- CAS:6027-23-2
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000Tons
|
| | Hordenine hydrochloride Basic information | | Uses |
| Product Name: | Hordenine hydrochloride | | Synonyms: | anhalinehydrochloride;dimethyl-beta-(4-hydroxyphenyl)ethylaminehydrochloride;eremursinehydrochloride;hordeninehydrochloride;n,n-dimethyltyraminehydrochloride;p-(2-(dimethylamino)ethyl)-phenohydrochloride;p-(2-dimethylaminoethyl)phenolhydrochloride;peyocactinehydrochloride | | CAS: | 6027-23-2 | | MF: | C10H16ClNO | | MW: | 201.69 | | EINECS: | 227-892-6 | | Product Categories: | Herb extract;OLED | | Mol File: | 6027-23-2.mol |  |
| | Hordenine hydrochloride Chemical Properties |
| Melting point | 178 °C | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C10H15NO.ClH/c1-11(2)8-7-9-3-5-10(12)6-4-9;/h3-6,12H,7-8H2,1-2H3;1H | | InChIKey | KIZRJFIRFPIRFS-UHFFFAOYSA-N | | SMILES | C1(CCN(C)C)C=CC(O)=CC=1.Cl | | CAS DataBase Reference | 6027-23-2(CAS DataBase Reference) |
| | Hordenine hydrochloride Usage And Synthesis |
| Uses | Hordenine HCL acts with the effect of relaxing bronchial smooth muscle, constricting blood vessels, vasopressurization, elevating blood pressure and excitation of the central nervous system. It can enhance the uterine tension and co-movement, and has quantitative effect. | | Chemical Properties | White powder | | Food chemistry | In the food and supplement industries, Hordenine Hydrochloride is used primarily for its ability to enhance energy levels, promote fat loss, and improve cognitive function. | | Source | Hordenine hydrochloride is an alkaloid compound derived from plants, particularly from barley. |
| | Hordenine hydrochloride Preparation Products And Raw materials |
|