| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | RATJADONE A Basic information |
| Product Name: | RATJADONE A | | Synonyms: | RATJADON;RATJADONE;RATJADONE A;2H-Pyran-2-one, 5,6-dihydro-6-[(1E,3Z,5R,7E,9E,11R)-11-hydroxy-3,5,7-trimethyl-11-[(2S,4R,5S,6S)-tetrahydro-4-hydroxy-5-methyl-6-(1E)-1-propen-1-yl-2H-pyran-2-yl]-1,3,7,9-undecatetraen-1-yl]-, (6R)- | | CAS: | 163564-92-9 | | MF: | C28H40O5 | | MW: | 456.61 | | EINECS: | | | Product Categories: | | | Mol File: | 163564-92-9.mol |  |
| | RATJADONE A Chemical Properties |
| storage temp. | -70°C | | solubility | aqueous buffer: ≤100μM
methanol: 20mg/mL | | form | Clear liquid. | | InChIKey | CAYGMWMWJUFODP-AYFTZVAISA-N | | SMILES | O1[C@H]([C@H]([C@@H](C[C@H]1[C@H](O)\C=C\C=C(\C[C@@H](C)\C=C(\C)/C=C/[C@@H]2OC(=O)C=CC2)/C)O)C)\C=C\C |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | RATJADONE A Usage And Synthesis |
| Uses | Ratjadone A, Synthetic is a cell-permeable polyketide that inhibits cell proliferation. | | Biological Activity | Cell permeable: yes', 'Primary Target
nuclear export of LR-NES', 'Product does not compete with ATP.', 'Reversible: no', 'Target IC50: ≤ 1 ng/ml for inhibiting proliferation and inducing cell cycle arrest at G1 phase |
| | RATJADONE A Preparation Products And Raw materials |
|