|
|
| | Bis[4-(4-aminophenoxy)phenyl]sulfone Basic information |
| Product Name: | Bis[4-(4-aminophenoxy)phenyl]sulfone | | Synonyms: | BIS[4-(4-AMINOPHENOXY)PHENYL] SULFONE;4,4'-sulfonylbis(p-phenoxyaniline);4,4'-[SULFONYLBIS(P-PHENYLENEOXY)]DIANILINE;2,2-BIS [4-(4-AMINOPHENOXY) PHENYL] SULFONE;4,4’-(sulfonylbis(4,1-phenyleneoxy))bis-benzenamin;4,4’-(sulfonylbis(4,1-phenyleneoxy))bisbenzenamine;4,4’-(sulfonylbis(p-phenyleneoxy))di-anilin;4,4’-[sulfonylbis(4,1-phenyleneoxy)]bis-benzenamin | | CAS: | 13080-89-2 | | MF: | C24H20N2O4S | | MW: | 432.49 | | EINECS: | 235-986-3 | | Product Categories: | Diphenyl Sulfones (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research | | Mol File: | 13080-89-2.mol | ![Bis[4-(4-aminophenoxy)phenyl]sulfone Structure](CAS/GIF/13080-89-2.gif) |
| | Bis[4-(4-aminophenoxy)phenyl]sulfone Chemical Properties |
| Melting point | 195 °C | | Boiling point | 655.3±55.0 °C(Predicted) | | density | 1.2136 (rough estimate) | | refractive index | 1.6510 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Acetone | | pka | 4.54±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C24H20N2O4S/c25-17-1-5-19(6-2-17)29-21-9-13-23(14-10-21)31(27,28)24-15-11-22(12-16-24)30-20-7-3-18(26)4-8-20/h1-16H,25-26H2 | | InChIKey | UTDAGHZGKXPRQI-UHFFFAOYSA-N | | SMILES | S(C1=CC=C(OC2=CC=C(N)C=C2)C=C1)(C1=CC=C(OC2=CC=C(N)C=C2)C=C1)(=O)=O | | CAS DataBase Reference | 13080-89-2(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, 4,4'-[sulfonylbis(4,1-phenyleneoxy)]bis- (13080-89-2) |
| RIDADR | 2811 | | RTECS | BY8955000 | | TSCA | TSCA listed | | HS Code | 2930.90.2900 | | HazardClass | 6.1 | | PackingGroup | III | | Toxicity | rabbit,LD50,skin,560mg/kg (560mg/kg),Toxicology and Applied Pharmacology. Vol. 28, Pg. 313, 1974. |
| | Bis[4-(4-aminophenoxy)phenyl]sulfone Usage And Synthesis |
| | Bis[4-(4-aminophenoxy)phenyl]sulfone Preparation Products And Raw materials |
|