(1R,2R)-trans-N-Boc-2-Aminocyclohexanol manufacturers
|
| | (1R,2R)-trans-N-Boc-2-Aminocyclohexanol Basic information |
| Product Name: | (1R,2R)-trans-N-Boc-2-Aminocyclohexanol | | Synonyms: | (1R,2R)-trans-N-Boc-2-Aminocyclohexanol;tert-butyl N-[(1R,2R)-2-hydroxycyclohexyl]carbamate;Carbamic acid, N-[(1R,2R)-2-hydroxycyclohexyl]-, 1,1-dimethylethyl ester;(1R,2R)-N-Boc-2-aminocyclohexanol;(1R,2R)-N-Boc-2-aminocyclohexanol,99%e.e.;172618;(1R,2R)-trans-2-(N-tert-butyloxycarbonyl)amino-1-cyclohexanol;1H-Inden-2-ol,1-amino-2,3-dihydro-,(1R,5S)- | | CAS: | 155975-19-2 | | MF: | C11H21NO3 | | MW: | 215.29 | | EINECS: | | | Product Categories: | Amino Alcohols;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 155975-19-2.mol |  |
| | (1R,2R)-trans-N-Boc-2-Aminocyclohexanol Chemical Properties |
| Melting point | 110 °C | | Boiling point | 337.7±31.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.11±0.40(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]/D +4.9±0.5°, c = 1 in chloroform | | BRN | 6921870 | | InChI | 1S/C11H21NO3/c1-11(2,3)15-10(14)12-8-6-4-5-7-9(8)13/h8-9,13H,4-7H2,1-3H3,(H,12,14)/t8-,9-/m1/s1 | | InChIKey | XVROWZPERFUOCE-RKDXNWHRSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1O |
| Hazard Codes | Xn,N | | Risk Statements | 22-50 | | Safety Statements | 61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1 |
| | (1R,2R)-trans-N-Boc-2-Aminocyclohexanol Usage And Synthesis |
| Synthesis | Step B: Preparation of tert-butyl (1R,2R)-(2-hydroxycyclohexyl)carbamate
To a mixed solution of tert-butyl (1R,2R)-(2-benzyloxycyclohexyl)carbamate (7 g, 23 mmol) in ethyl acetate and methanol (80 mL, 9:1) was added 10% Pd-C catalyst (1.13 g). The hydrogenation reaction was carried out at 35 psi hydrogen pressure for 4 hours. Upon completion of the reaction, it was filtered through a diatomaceous earth pad to remove the catalyst. The filtrate was concentrated to give the target product (Cas:155975-19-2) as an oil (4.7 g, 95% yield). Mass spectrometry (MS) analysis: (M + 1): 215.95. | | References | [1] Patent: US2007/287695, 2007, A1. Location in patent: Page/Page column 14; 55
[2] Bioorganic and Medicinal Chemistry, 2009, vol. 17, # 1, p. 119 - 132 |
| | (1R,2R)-trans-N-Boc-2-Aminocyclohexanol Preparation Products And Raw materials |
|