| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione Basic information |
| | 2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione Chemical Properties |
| Melting point | 213-217 °C | | form | solid | | InChI | 1S/C11H11BINO4/c1-14-6-10(15)17-12(18-11(16)7-14)8-2-4-9(13)5-3-8/h2-5H,6-7H2,1H3 | | InChIKey | KIKNJEGAWBNFLW-UHFFFAOYSA-N | | SMILES | CN1CC(=O)OB(OC(=O)C1)c2ccc(I)cc2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione Usage And Synthesis |
| Uses | 4-Iodophenylboronic acid MIDA ester can be used:
- As a starting material to prepare rod-like hydrogen-bonded organic frameworks through Stille-coupling using 2,5-bis(trimethyltin)heterocycle, Pd(PPh3)4, and CuI.
- As a substrate in the C-H arylation reaction of pyroglutamic acid derivatives with aryl and heteroaryl iodides; catalyzed by the palladium catalyst.
- As a substrate in the synthesis of trifluoroborates, which are further converted to protected boronic acids.
- As a starting material in the synthesis of amino acid MIDA boronates as new building blocks by reacting with protected iodoalanine.
|
| | 2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione Preparation Products And Raw materials |
|