|
|
| | ANILINE-D7 Basic information |
| Product Name: | ANILINE-D7 | | Synonyms: | (2,3,4,5,6,N,N-2H7)Aniline;(2,3,4,5,6-2H5)Benzene-1-(N,N-2H2)amine;(2H7)Benzenamine;Benzeneamine-d7;Aniline-d7,for NMR,99 atom% D;Aniline-d7
(Discontinued, see A662477);Aniline-d7;ANILINE-D7 | | CAS: | 14545-23-4 | | MF: | C6D7N | | MW: | 100.17 | | EINECS: | 238-580-4 | | Product Categories: | Alphabetical Listings;Stable Isotopes;A | | Mol File: | 14545-23-4.mol |  |
| | ANILINE-D7 Chemical Properties |
| Melting point | -6 °C(lit.) | | Boiling point | 184 °C(lit.) | | density | 1.098 g/mL at 25 °C | | refractive index | n20/D 1.5824(lit.) | | Fp | 158 °F | | storage temp. | 2-8°C | | Stability: | Stable, but light sensitive. May discolour upon exposure to air or light. Incompatible with oxidizing agents, bases, iron, iron salts, aluminium, zinc. | | InChI | 1S/C6H7N/c7-6-4-2-1-3-5-6/h1-5H,7H2/i1D,2D,3D,4D,5D/hD2 | | InChIKey | PAYRUJLWNCNPSJ-LQHBDRBESA-N | | SMILES | [2H]N([2H])c1c([2H])c([2H])c([2H])c([2H])c1[2H] | | EPA Substance Registry System | Aniline-d7 (14545-23-4) | | CAS Number Unlabeled | 62-53-3 |
| Hazard Codes | T,N | | Risk Statements | 20/21/22-40-48/23/24/25-50-68-43-41-23/24/25 | | Safety Statements | 28-36/37-45-61-36/37/39-26-63-46-27 | | RIDADR | UN 1547 6.1/PG 2 | | WGK Germany | 3 | | HS Code | 28459000 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
Eye Dam. 1
Muta. 2
Skin Sens. 1
STOT RE 1 |
| | ANILINE-D7 Usage And Synthesis |
| Chemical Properties | colourless to light yellow liquid | | Uses | Aniline-d7 is used in the manufacture of dyes, medicinals, resins, varnishes, perfumes, as a vulcanizing rubber or even as a solvent. This is the deuterium labeled analog. | | Synthesis | Aniline-d7 was prepared as follows: in the reaction flask add aniline 10mmol, heavy water 20mL and SOCl20.3mL in turn, reflux reaction 24h. cooled to room temperature, TLC detected the reaction was complete [unfolding agent: A = V (ethyl acetate): V (petroleum ether) = 1:10], with saturated sodium bicarbonate solution to pH 7, with ethyl acetate (3 20mL) Extracted with ethyl acetate (320mL), the organic layers were combined, washed with saturated saline (215mL), dried with anhydrous Na2SO4, filtered, and the filtrate was concentrated and then purified by silica gel column chromatography (eluent: A=1:20) to obtain deuterated aniline (Aniline-d7). |
| | ANILINE-D7 Preparation Products And Raw materials |
|