|
|
| | 2-fluoro-3-trifluoromethoxy aniline Basic information |
| Product Name: | 2-fluoro-3-trifluoromethoxy aniline | | Synonyms: | 2-fluoro-3-trifluoromethoxy aniline;2-Fluoro-5-(trifluoromethoxy)aniline, JRD, 97%;2-Fluoro-5-(trifluoromethoxy)aniline 99%;3-Amino-alpha,alpha,alpha,4-tetrafluoroanisole;2-Fluoro-5-(trifluoromethoxy);Benzenamine, 2-fluoro-5-(trifluoromethoxy)-;2-Fluoro-5-(trifluoromethoxy)aniline,97% | | CAS: | 116369-23-4 | | MF: | C7H5F4NO | | MW: | 195.11 | | EINECS: | | | Product Categories: | | | Mol File: | 116369-23-4.mol |  |
| | 2-fluoro-3-trifluoromethoxy aniline Chemical Properties |
| Boiling point | 190.5±35.0 °C(Predicted) | | density | 1.431±0.06 g/cm3(Predicted) | | refractive index | 1.4485 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | liquid | | pka | 1.97±0.10(Predicted) | | color | Clear, colourless | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C7H5F4NO/c8-5-2-1-4(3-6(5)12)13-7(9,10)11/h1-3H,12H2 | | InChIKey | HQUWXEXDIIWBBY-UHFFFAOYSA-N | | SMILES | C1(N)=CC(OC(F)(F)F)=CC=C1F |
| Hazard Codes | Xn | | Risk Statements | 22 | | HazardClass | 6.1 | | HS Code | 2922290090 |
| | 2-fluoro-3-trifluoromethoxy aniline Usage And Synthesis |
| Uses | In discovery of novel benzimidazoles as potent inhibitors of TIE-2 and VEGFR-2 tyrosine kinase receptors 2-Fluoro-5-(trifluoromethoxy)aniline is used as coupling agent. 2-Fluoro-5-(trifluoromethyl)aniline may be used in chemical synthesis studies. |
| | 2-fluoro-3-trifluoromethoxy aniline Preparation Products And Raw materials |
|