| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
InvivoChem |
| Tel: |
+1-708-310-1919 +1-13798911105 |
| Email: |
sales@invivochem.cn |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Company Name: |
InvivoChem |
| Tel: |
13549236410 |
| Email: |
sales@invivochem.cn |
(R)-(+)-SKF-38393 hydrochloride manufacturers
|
| | (R)-(+)-SKF-38393 hydrochloride Basic information |
| Product Name: | (R)-(+)-SKF-38393 hydrochloride | | Synonyms: | R(+)-SKF-38393 HYDROCHLORIDE;R-SKF-38393A HCl;RSKF38393A HCl,R SKF 38393A HCl;(R)-(+)-SKF38393 hydrochloride, D1 partial agonist;(R)-(+)-SKF-38393 hydrochloride | | CAS: | 81702-42-3 | | MF: | C16H17NO2.ClH | | MW: | 291.776 | | EINECS: | | | Product Categories: | | | Mol File: | 81702-42-3.mol |  |
| | (R)-(+)-SKF-38393 hydrochloride Chemical Properties |
| Melting point | 244-246 °C | | storage temp. | -20°C | | solubility | 0.1 M HCl: soluble1.2mg/mL | | form | solid | | color | off-white to light tan | | Optical Rotation | [α]22/D +16.1°, c = 1.2 in methanol(lit.) | | Water Solubility | water: 100mM | | InChI | 1S/C16H17NO2.ClH/c18-15-8-12-6-7-17-10-14(13(12)9-16(15)19)11-4-2-1-3-5-11;/h1-5,8-9,14,17-19H,6-7,10H2;1H/t14-;/m1./s1 | | InChIKey | YEWHJCLOUYPAOH-PFEQFJNWSA-N | | SMILES | Cl.Oc1cc2CCNC[C@H](c3ccccc3)c2cc1O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (R)-(+)-SKF-38393 hydrochloride Usage And Synthesis |
| Uses | (R)-(+)-SKF-38393 Hydrochloride is the active enantiomer of (±)-SKF-38393, a D1 dopamine receptor agonist. | | Uses | (R)-(+)-SKF-38393 hydrochloride has been used as a D1 dopamine receptor agonist to study its effect on the sleep-wake pattern of macaques rendered parkinsonian with 1-methyl-4-phenyl-1,2,3,6-tetrahydropyridine (MPTP). | | Biochem/physiol Actions | (R)-(+)-SKF-38393 hydrochloride is a D1 dopamine receptor agonist and an active enantiomer of (±)-SKF-38393. It enhances pertussis toxin-insensitive and protein kinase A-mediated glutamate release in the hippocampal neurons. SKF-38393, abenzazepine derivative, exhibits anorectic effects. |
| | (R)-(+)-SKF-38393 hydrochloride Preparation Products And Raw materials |
|
|
Tag:(R)-(+)-SKF-38393 hydrochloride(81702-42-3)
Related Product Information
|
|
(±)-SKF-77434 hydrobromide, (±)-7,8-Dihydroxy-3-allyl-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine hydrobromide
8-methoxy-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride
3-methyl-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol
1H-3-Benzazepine-7,8-diol, 2,3,4,5-tetrahydro-1-phenyl-3-(2-propenyl)-, (S)- (9CI)
Spiro[1H-indene-1,3-pyrrolidine]-5,6-diol, 2,3-dihydro- (9CI)
1H-3-Benzazepin-7-ol, 2,3,4,5-tetrahydro-5-methyl-, hydrobromide (1:1)
|