|
|
| | 2,6-bis(chloromethyl)pyridine Basic information |
| Product Name: | 2,6-bis(chloromethyl)pyridine | | Synonyms: | 2,6-BIS(CHLOROMETHYL)PYRIDINE;Nsc244971;2,6-Dichloro-3-methylpyridine hydrochloride;2,6-Bis-(Chloromethyl)-pyridine HCL;2,6-bis(chloromethyl)pyridine ISO 9001：2015 REACH;2,6-Bis(dichloromethylipyridine hydrochloride(DCMP);2,6-DichloromethyI Pyridine HCI;2,6-Bis(chloromethyl)pyridine hydrochloride (1:1) | | CAS: | 55422-79-2 | | MF: | C7H8Cl3N | | MW: | 212.5 | | EINECS: | | | Product Categories: | | | Mol File: | 55422-79-2.mol |  |
| | 2,6-bis(chloromethyl)pyridine Chemical Properties |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C | | InChI | InChI=1S/C7H7Cl2N.ClH/c8-4-6-2-1-3-7(5-9)10-6;/h1-3H,4-5H2;1H | | InChIKey | FGBGOYAWNBDXCH-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC(CCl)=N1)Cl.Cl |
| | 2,6-bis(chloromethyl)pyridine Usage And Synthesis |
| Uses | 2,6-Bis(chloromethyl)pyridine Hydrochloride can be used to treat cancer-related disorders. |
| | 2,6-bis(chloromethyl)pyridine Preparation Products And Raw materials |
|