|
|
| | 3,4-Dihydroxybenzophenone Basic information |
| | 3,4-Dihydroxybenzophenone Chemical Properties |
| Melting point | 144-148 °C (lit.) | | Boiling point | 314.35°C (rough estimate) | | density | 1.1956 (rough estimate) | | refractive index | 1.5090 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 8.02±0.18(Predicted) | | color | White to Light yellow to Green | | InChI | InChI=1S/C13H10O3/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9/h1-8,14-15H | | InChIKey | ARWCZKJISXFBGI-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(O)C(O)=C1)(C1=CC=CC=C1)=O | | CAS DataBase Reference | 10425-11-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 29145090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,4-Dihydroxybenzophenone Usage And Synthesis |
| Chemical Properties | cream crystalline powder | | Preparation | Preparation by Fries rearrangement of pyrocatechol dibenzoate,
in the presence of aluminium chloride in nitrobenzene at 100° for 4 h (quantitative yield) or heated on a steam bath for 6 h ];
in the presence of Nafion-XR, a H+-form ion exchange resin, at 175° for 4 h under nitrogen (38%). | | Synthesis Reference(s) | Tetrahedron Letters, 35, p. 2601, 1994 DOI: 10.1016/S0040-4039(00)77182-6 |
| | 3,4-Dihydroxybenzophenone Preparation Products And Raw materials |
|