1,4-DIFLUOROANTHRAQUINONE manufacturers
|
| | 1,4-DIFLUOROANTHRAQUINONE Basic information |
| Product Name: | 1,4-DIFLUOROANTHRAQUINONE | | Synonyms: | 1,4-Difluoroanthrquioneone;1,4-DIFLUOROANTHRAQUINONE;9,10-Anthracenedione, 1,4-difluoro;1,4-Difluoroanthraquinone 96%;1,4-difluoro-9,10-dihydroanthracene-9,10-dione;1,4-DIFLUOROANTHRAQUINONE ISO 9001：2015 REACH;1,4-difluorine-9,10-anthracenedione;1,4-Difluoroanthracene-9,10-dione - [D94548] | | CAS: | 28736-42-7 | | MF: | C14H6F2O2 | | MW: | 244.19 | | EINECS: | | | Product Categories: | PAHs series;C13 to C14;Carbonyl Compounds;Ketones | | Mol File: | 28736-42-7.mol |  |
| | 1,4-DIFLUOROANTHRAQUINONE Chemical Properties |
| Melting point | 228-232 °C(lit.) | | Boiling point | 401.3±45.0 °C(Predicted) | | density | 1.457±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C14H6F2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6H | | InChIKey | DTNCXQHDOJRTCD-UHFFFAOYSA-N | | SMILES | C1(F)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=C(F)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-43 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | 1,4-DIFLUOROANTHRAQUINONE Usage And Synthesis |
| | 1,4-DIFLUOROANTHRAQUINONE Preparation Products And Raw materials |
| Raw materials | Anthracene, 1,4,9,9,10,10-hexachloro-9,10-dihydro--->Benzoic acid, 2-benzoyl-3,6-difluoro--->3-Cyanophthalide
-->3,6-DIFLUOROPHTHALIC ANHYDRIDE-->2,3-DIHYDRO-9,10-DIHYDROXY-1,4-ANTHRACENEDIONE-->1-Bromo-2,5-difluorobenzene-->1,4-Dihydroxyanthraquinone-->1,4-DICHLOROANTHRAQUINONE-->1,4-Difluorobenzene | | Preparation Products | Solvent Blue 35-->1,4-bis[(2-hydroxyethyl)amino]anthraquinone |
|