|
|
| | 2,3,6-Trifluorobenzonitrile Basic information | | Application |
| Product Name: | 2,3,6-Trifluorobenzonitrile | | Synonyms: | 2,3,6-TRIFLUOROBENZONITRILE;Benzonitrile, 2,3,6-trifluoro- (9CI);3-flurobenzalcohol;2,3,6-Trifluorobenzonitrile 99%;2,3,6-Trifluorobenzonitrile99%;2,4-dichloro-3-cyano-5-fluorobenzoic acid;Benzonitrile, 2,3,6-trifluoro- | | CAS: | 136514-17-5 | | MF: | C7H2F3N | | MW: | 157.09 | | EINECS: | | | Product Categories: | Fluorine series;Nitrile;C6 to C7;Cyanides/Nitriles;Nitrogen Compounds;HALIDE;Aromatic Nitriles | | Mol File: | 136514-17-5.mol |  |
| | 2,3,6-Trifluorobenzonitrile Chemical Properties |
| Boiling point | 179°C | | density | 1.359 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4706(lit.) | | Fp | 174 °F | | storage temp. | Storage temp. 2-8°C | | form | liquid | | color | Clear, colourless | | Specific Gravity | 1.360 | | BRN | 5427616 | | InChI | InChI=1S/C7H2F3N/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2H | | InChIKey | YWTXHALVWAISPR-UHFFFAOYSA-N | | SMILES | C(#N)C1=C(F)C=CC(F)=C1F | | CAS DataBase Reference | 136514-17-5(CAS DataBase Reference) |
| | 2,3,6-Trifluorobenzonitrile Usage And Synthesis |
| Application | 2,3,6-Trifluorobenzonitrile is often used as an important intermediate in organic synthesis. By transforming the fluorine atoms on its benzene ring, a variety of organic molecules with specific structures and functions can be synthesized. Furthermore, it has some applications in the field of materials science, specifically in the structural modification of liquid crystal materials. | | Chemical Properties | 2,3,6-Trifluorobenzonitrile is a colorless transparent liquid at room temperature and pressure, insoluble in water but miscible with common organic solvents. The fluorine atom at position 2 in its structure can be defluorinated under the attack of strong nucleophilic reagents, which can be used for the synthesis of biologically active molecules of polysubstituted benzonitrile. |
| | 2,3,6-Trifluorobenzonitrile Preparation Products And Raw materials |
|