|
|
| | 3-Hydroxy-6-methylpyridine Basic information |
| | 3-Hydroxy-6-methylpyridine Chemical Properties |
| Melting point | 168-170 °C(lit.) | | Boiling point | 204.59°C (rough estimate) | | density | 1.1143 (rough estimate) | | refractive index | 1.5040 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | dichloromethane: soluble | | pka | 9.49±0.10(Predicted) | | form | Crystalline Powder | | color | Beige to light tan | | BRN | 107077 | | InChI | InChI=1S/C6H7NO/c1-5-2-3-6(8)4-7-5/h2-4,8H,1H3 | | InChIKey | DHLUJPLHLZJUBW-UHFFFAOYSA-N | | SMILES | C1=NC(C)=CC=C1O | | LogP | 0.418 (est) | | CAS DataBase Reference | 1121-78-4(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Pyridinol, 6-methyl-(1121-78-4) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-37/38-41-40-36/37/38 | | Safety Statements | 26-39-24/25-36-22 | | WGK Germany | 3 | | RTECS | UU7714900 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 | | Toxicity | mouse,LD50,intraperitoneal,846mg/kg (846mg/kg),Toxicon. Vol. 23, Pg. 815, 1985. |
| | 3-Hydroxy-6-methylpyridine Usage And Synthesis |
| Chemical Properties | beige to light tan crystalline powder | | Uses | - 5-Hydroxy-2-methylpyridine was used as starting reagent for the synthesis of 5-[(4-methoxybenzyl)oxy]-2-pyridinecarbaldehyde.
- It was used in synthesis of [HNC6H6OH]2[Cu(NC5H5)4(NbOF5)2].
- It was used as ligand of a platinum complex which showed protein kinase inhibitory action at nanomolar levels.
- It forms a chiral pyridinium ionic liquid on reaction with L-menthol chloromethyl ether.
|
| | 3-Hydroxy-6-methylpyridine Preparation Products And Raw materials |
|