2-(4-Methoxyphenyl)-3,5,7-trimethoxy-4H-1-benzopyran-4-one manufacturers
|
| | 2-(4-Methoxyphenyl)-3,5,7-trimethoxy-4H-1-benzopyran-4-one Basic information |
| Product Name: | 2-(4-Methoxyphenyl)-3,5,7-trimethoxy-4H-1-benzopyran-4-one | | Synonyms: | 2-(4-Methoxyphenyl)-3,5,7-trimethoxy-4H-1-benzopyran-4-one;Tetramethylkaempferol;4H-1-Benzopyran-4-one, 3,5,7-trimethoxy-2-(4-methoxyphenyl)-;Kaempferol tetramethyl ether;3,5,7,4'-Tetramethoxyflavone;Tetramethylkaempferol, 10 mM in DMSO;3,4',5,7-tetramethoxyflavone | | CAS: | 16692-52-7 | | MF: | C19H18O6 | | MW: | 342.34 | | EINECS: | | | Product Categories: | | | Mol File: | 16692-52-7.mol |  |
| | 2-(4-Methoxyphenyl)-3,5,7-trimethoxy-4H-1-benzopyran-4-one Chemical Properties |
| Melting point | 114-116 °C | | Boiling point | 540.6±50.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)18-19(24-4)17(20)16-14(23-3)9-13(22-2)10-15(16)25-18/h5-10H,1-4H3 | | InChIKey | YZWIIEJLESXODL-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(OC)C=C2)OC2=CC(OC)=CC(OC)=C2C(=O)C=1OC |
| | 2-(4-Methoxyphenyl)-3,5,7-trimethoxy-4H-1-benzopyran-4-one Usage And Synthesis |
| Uses | Tetramethylkaempferol is an antifungal agent. Tetramethylkaempferol shows antifungal activity against Candida albicansCandida albicans with an IC50 value of 17.63 μg/mL[1]. | | References | [1] Yenjai C, et al. Bioactive flavonoids from Kaempferia parviflora. Fitoterapia. 2004 Jan;75(1):89-92. DOI:10.1016/j.fitote.2003.08.017 |
| | 2-(4-Methoxyphenyl)-3,5,7-trimethoxy-4H-1-benzopyran-4-one Preparation Products And Raw materials |
|