|
|
| | 1-Phenyl-1,2,3,4-tetrahydro-isoquinoline Basic information |
| Product Name: | 1-Phenyl-1,2,3,4-tetrahydro-isoquinoline | | Synonyms: | 1-Phenyl-1,2,3,4-Tetrahydroiso;1,2,3,4-tetrahydro-1-phenylisoquinoline;1-PHENYL-1,2,3,4-TETRAHYDRO-ISOQUINOLINE 99%;1-Phenyl-1,2,3,4-tetrahydro-isoquinoline;1-Phenyl-2,3,4,9-tetrahydro-1H-carboline-3-carboxylicacid;Isoquinoline, 1,2,3,4-tetrahydro-1-phenyl-;Phenyl-tiq;(RS)-1-phenyl-1,2,3,4-tetrahydroisoquinoline | | CAS: | 22990-19-8 | | MF: | C15H15N | | MW: | 209.29 | | EINECS: | 248-592-1 | | Product Categories: | Tetrahydroisoquinolines | | Mol File: | 22990-19-8.mol |  |
| | 1-Phenyl-1,2,3,4-tetrahydro-isoquinoline Chemical Properties |
| Melting point | 98.0 to 102.0 °C | | Boiling point | 338.4±11.0 °C(Predicted) | | density | 1.065±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.91±0.40(Predicted) | | color | Off-White | | λmax | 265nm(EtOH)(lit.) | | InChI | InChI=1S/C15H15N/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15/h1-9,15-16H,10-11H2 | | InChIKey | PRTRSEDVLBBFJZ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)C2=C(C=CC=C2)CCN1 | | CAS DataBase Reference | 22990-19-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2933.49.7000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-Phenyl-1,2,3,4-tetrahydro-isoquinoline Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 1-Phenyl-1,2,3,4-tetrahydroisoquinoline is a Solifenacin (S676700) intermediate. 1-Phenyl-1,2,3,4-tetrahydroisoquinoline had been detected in parkinsonian human brain. 1-Phenyl-1,2,3,4-tetrahydroisoquinoline maybe a candidate for endogenous MPTP-like neurotoxin since it is a structural analogue of MPTP which produces parkinsonism in humans. |
| | 1-Phenyl-1,2,3,4-tetrahydro-isoquinoline Preparation Products And Raw materials |
|