|
|
| | 4-(Trifluoromethylthio)phenol Basic information |
| | 4-(Trifluoromethylthio)phenol Chemical Properties |
| Melting point | 57-60 °C (lit.) | | Boiling point | 77-78 °C/7 mmHg (lit.) | | density | 1.45 | | Fp | 57°C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 8.53±0.13(Predicted) | | color | White to Almost white | | Sensitive | Stench | | InChI | InChI=1S/C7H5F3OS/c8-7(9,10)12-6-3-1-5(11)2-4-6/h1-4,11H | | InChIKey | YYCPTWHVKSATQK-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(SC(F)(F)F)C=C1 | | CAS DataBase Reference | 461-84-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT, STENCH | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(Trifluoromethylthio)phenol Usage And Synthesis |
| Chemical Properties | Colorless or light yellow crystalline | | Uses | 4-(Trifluoromethylthio)phenol may be used in the preparation of phenylamino derivative, which is an important intermediate in the synthesis of toltrazuril. | | General Description | 4-(Trifluoromethylthio)phenol undergoes reaction with NBS (N-Bromosuccinimide), NIS (N-Iodosuccinimide), HNO3, HNO3/H2SO4 and 4-bromobenzyl bromide to afford bromo-, iodo-, nitro- and benzyl substituted products. |
| | 4-(Trifluoromethylthio)phenol Preparation Products And Raw materials |
|