| Company Name: |
Shaanxi Didu New Materials Co. Ltd
|
| Tel: |
+86-89586680 +86-13289823923 |
| Email: |
1026@dideu.com |
| Products Intro: |
Product Name:Formalin;2,2,3,4,4,5,5-Heptachlorobiphenyl CAS:35065-29-3 Purity:0.99 Package:25KG,200L
|
|
| | 2,2',3,4,4',5,5'-HEPTACHLOROBIPHENYL Basic information |
| Product Name: | 2,2',3,4,4',5,5'-HEPTACHLOROBIPHENYL | | Synonyms: | 2,2',3,4,4',5,5'-Heptachloro-1,1'-biphenyl;2,3,4,5,2',4',5'-Heptachlorobiphenyl;PCB-180;PCB NO 180;NO 180;2,2',3',4,4',5,5'-HEPTACHLOROBIPHENYL;2,2',3,4,4',5,5'-PCB;46433, 2,2',3,4,4',5,5'-Heptachlorobiphe nyl (IUPAC No. 180) (purity) | | CAS: | 35065-29-3 | | MF: | C12H3Cl7 | | MW: | 395.32 | | EINECS: | 621-378-9 | | Product Categories: | | | Mol File: | 35065-29-3.mol |  |
| | 2,2',3,4,4',5,5'-HEPTACHLOROBIPHENYL Chemical Properties |
| Melting point | 114℃ | | Boiling point | 479.43°C (rough estimate) | | density | 1.64 g/cm3 (65℃) | | refractive index | 1.6330 (rough estimate) | | Fp | -12 °C | | storage temp. | 2-8°C | | solubility | Acetone (Slightly), Acetonitrile (Slightly), Chloroform (Slightly) | | Water Solubility | 3.85ug/L(20 ºC) | | BRN | 2509255 | | InChI | InChI=1S/C12H3Cl7/c13-6-3-8(15)7(14)1-4(6)5-2-9(16)11(18)12(19)10(5)17/h1-3H | | InChIKey | WBHQEUPUMONIKF-UHFFFAOYSA-N | | SMILES | C1(C2=CC(Cl)=C(Cl)C=C2Cl)=CC(Cl)=C(Cl)C(Cl)=C1Cl | | EPA Substance Registry System | 2,2',3,4,4',5,5'-Heptachlorobiphenyl (35065-29-3) |
| | 2,2',3,4,4',5,5'-HEPTACHLOROBIPHENYL Usage And Synthesis |
| Uses | 2,2',3,4,4',5,5'-Heptachlorobiphenyl is a polychlorinated biphenyl (PCB) found in air, soil, mammals, and marine animals. | | Definition | ChEBI: PCB180 is a polychlorobiphenyl. |
| | 2,2',3,4,4',5,5'-HEPTACHLOROBIPHENYL Preparation Products And Raw materials |
| Raw materials | 2,3,4,5-TETRACHLOROANILINE-->1,2,4-Trichlorobenzene | | Preparation Products | 2,2',4,4',5,5'-HEXACHLOROBIPHENYL-->2,4,4'-TRICHLOROBIPHENYL |
|