|
|
| | DL-2-AMINO-4-PENTENOIC ACID Basic information |
| Product Name: | DL-2-AMINO-4-PENTENOIC ACID | | Synonyms: | DL-2-aminopent-4-enoic acid;DL-Allylglycine 2-Amino-4-pentenoic acid;ALLYLGLYCINE[ALLYGLY];(+/-)-2-AMINO-4-PENTENOIC ACID BIOCHEMIKA;2-Amino-4-pentanoic acid;2-Aminopent-4-enoic acid;rac-(2R*)-2-Amino-4-pentenoic acid;rac-(R*)-2-Allylglycine | | CAS: | 7685-44-1 | | MF: | C5H9NO2 | | MW: | 115.13 | | EINECS: | 231-689-8 | | Product Categories: | Pyridines | | Mol File: | 7685-44-1.mol |  |
| | DL-2-AMINO-4-PENTENOIC ACID Chemical Properties |
| Melting point | 258-260 °C(lit.) | | Boiling point | 215.41°C (rough estimate) | | density | 1.1808 (rough estimate) | | refractive index | 1.4538 (estimate) | | storage temp. | -20°C | | Water Solubility | Soluble in water | | pka | 2.22±0.10(Predicted) | | form | Crystalline Powder | | color | White | | BRN | 1748645 | | Major Application | peptide synthesis | | InChI | InChI=1S/C5H9NO2/c1-2-3-4(6)5(7)8/h2,4H,1,3,6H2,(H,7,8) | | InChIKey | WNNNWFKQCKFSDK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(N)CC=C | | CAS DataBase Reference | 7685-44-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36/37-36 | | WGK Germany | 3 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | DL-2-AMINO-4-PENTENOIC ACID Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | peptide synthesis | | Biochem/physiol Actions | DL-2-Allylglycine is a racemic mixture of L- and D-allylglycine. D-allylglycine is the enantiomer of L-allylglycine, a glutamate decarboxylase (GAD) inhibitor used in GABA research. D-allylglycine may be used as a control supplement versus L-allylglycine in GABA research. D-allylglycine is used in the organic synthesis of cyclic opioid peptide agonists and antagonists. | | Purification Methods | Dissolve it in absolute EtOH and precipitate it with pyridine, then recrystallise it from aqueous EtOH [RF on paper in BuOH/EtOH/NH3/H2O (4:4:1:1:) is 0.37]. The hydrobromide has m 136-140o (from EtOAc) and the phenylureido derivative has m 159-161o. [Schgl Monatsh Chem 89 377 1958, Beilstein 4 IV 2852.] |
| | DL-2-AMINO-4-PENTENOIC ACID Preparation Products And Raw materials |
|