|
|
| | 4-Thiophenyl phenyl diphenyl sulfonium hexafluoroantimonate Basic information |
| Product Name: | 4-Thiophenyl phenyl diphenyl sulfonium hexafluoroantimonate | | Synonyms: | SulfoniuM, diphenyl[4-(phenylthio)phenyl]-, (OC-6-11)-hexafluoroantiMonate(1-) (1:1);(THIOPHENOXYPHENYL)DIPHENYLSULFONIUM HEXAFLUOROANTIMONATE-BIS(BIS(DIPHENYLSULFONIUM)DIPHENYLTHIOETHER HEXAFLUOROANTIMONATE BLEND, 50% in propylene carbonate;CAT6992 200G;4-thiophenyl phenyl diphenyl sulfonium;YF-PAG-002;diphenyl[4-(phenylthio)phenyl]-sulfoniu(oc-6-11)-hexafluoroantimonate(1-);Sulfonium,diphenyl[4-(phenylthio)phenyl]-,hexafluoroantimonate;(THIOPHENOXYPHENYL)DIPHENYLSULFONIUM HEXAFLUOROANTIMONATE-BIS(DIPHENYLSULFONIUM(DIPHENYLTHIOETHER HEXAFLUOROANTIMONATE)) BLEND | | CAS: | 71449-78-0 | | MF: | C24H19F6S2Sb | | MW: | 607.29 | | EINECS: | 680-227-5 | | Product Categories: | Mixed triarylsulfonium hexafluoro antimonate salts | | Mol File: | 71449-78-0.mol |  |
| | 4-Thiophenyl phenyl diphenyl sulfonium hexafluoroantimonate Chemical Properties |
| Melting point | 118-119 °C | | density | 1,4 g/cm3 | | vapor pressure | 0.002Pa at 25℃ | | Fp | 145°C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Sparingly), DMSO (Sparingly) | | form | Solid | | color | White to Off-White | | Specific Gravity | 1.40 | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/C24H19S2.6FH.Sb/c1-4-10-20(11-5-1)25-21-16-18-24(19-17-21)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23;;;;;;;/h1-19H;6*1H;/q+1;;;;;;;+5/p-6 | | InChIKey | SQPBZCDQRJYQKD-UHFFFAOYSA-H | | SMILES | [S+](C1=CC=CC=C1)(C1=CC=CC=C1)C1C=CC(SC2=CC=CC=C2)=CC=1.[Sb-](F)(F)(F)(F)(F)F | | LogP | -0.426 at 20℃ | | EPA Substance Registry System | Sulfonium, diphenyl[4-(phenylthio)phenyl]-, (OC-6-11)-hexafluoroantimonate(1-) (71449-78-0) |
| Risk Statements | 20/22-51/53 | | Safety Statements | 26-36/37/39 | | RIDADR | 1549 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III |
| | 4-Thiophenyl phenyl diphenyl sulfonium hexafluoroantimonate Usage And Synthesis |
| Uses | 4-Thiophenyl Phenyl Diphenyl Sulfonium Hexafluoroantimonate is used as a catalyst for photocuring of epoxy resins. | | Flammability and Explosibility | Not classified |
| | 4-Thiophenyl phenyl diphenyl sulfonium hexafluoroantimonate Preparation Products And Raw materials |
|