|
|
| | 1-TERT-BUTOXYCARBONYL-1,2,4-TRIAZOLE Basic information |
| Product Name: | 1-TERT-BUTOXYCARBONYL-1,2,4-TRIAZOLE | | Synonyms: | LABOTEST-BB LT00771764;1-BOC-1H-1,2,4-TRIAZOLE;1-BOC-1,2,4-TRIAZOLE;1-TERT-BUTOXYCARBONYL-1,2,4-TRIAZOLE;1-(TERT-BUTOXYCARBONYL)1H-1,2,4-TRIAZOLE;1-T-boc-1H-1,2,4-triazole;Butoxycarbonyltriazole;1-tert-butyl 1H-1,2,4-triazole-1-carboxylate | | CAS: | 41864-24-8 | | MF: | C7H11N3O2 | | MW: | 169.18 | | EINECS: | 255-570-5 | | Product Categories: | Biochemistry;Peptide Synthesis;Protection & Derivatization Reagents (for Synthesis);Protective Reagents (Peptide Synthesis);Synthetic Organic Chemistry | | Mol File: | 41864-24-8.mol |  |
| | 1-TERT-BUTOXYCARBONYL-1,2,4-TRIAZOLE Chemical Properties |
| Melting point | 43-47 °C | | Boiling point | 75 °C0.35 mm Hg(lit.) | | storage temp. | Inert atmosphere,2-8°C | | solubility | soluble in DMF and DMSO | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C7H11N3O2/c1-7(2,3)12-6(11)10-5-8-4-9-10/h4-5H,1-3H3 | | InChIKey | XWUFRDJEUOAMNW-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C=NC=N1 |
| | 1-TERT-BUTOXYCARBONYL-1,2,4-TRIAZOLE Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 1-tert-Butoxycarbonyl-1,2,4-triazole is a reagent for protection of amines with the t-butoxycarbonyl group. | | Synthesis |
1-tert-Butoxycarbonyl-1,2,4-triazole can readily be prepared from the reaction of t-butoxycarbonyl azide with 1-trimethylsilyl-1,2,4-triazole or reaction of t-butanol with N,N′-carbonyl-di-1,2,4-triazole in high yield.
|
| | 1-TERT-BUTOXYCARBONYL-1,2,4-TRIAZOLE Preparation Products And Raw materials |
|